About 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane
5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane (PubChem CID 14769315) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane.
Molecular Properties
| Compound Name | 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane |
| PubChem CID | 14769315 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane |
| SMILES | CC1(C)OCC(C2=CCCCC2)([N+](=O)[O-])CO1 |
| InChI | InChI=1S/C12H19NO4/c1-11(2)16-8-12(9-17-11,13(14)15)10-6-4-3-5-7-10/h6H,3-5,7-9H2,1-2H3 |
| InChIKey | SZWXOVLTJDHEHI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane?
The IUPAC name of 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane (CID 14769315) is 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane.
What is the SMILES notation for 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane?
The canonical SMILES for 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane is CC1(C)OCC(C2=CCCCC2)([N+](=O)[O-])CO1.
What is the InChIKey of 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane?
The InChIKey is SZWXOVLTJDHEHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO4/c1-11(2)16-8-12(9-17-11,13(14)15)10-6-4-3-5-7-10/h6H,3-5,7-9H2,1-2H3.
What are the key properties of 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane?
5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane has a molecular weight of 241.29 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclohexen-1-yl)-2,2-dimethyl-5-nitro-1,3-dioxane is sourced from PubChem (CID 14769315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).