About 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one
10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one (PubChem CID 14770037) has the molecular formula C19H15NO2S
and a molecular weight of 321.40 g/mol. Its IUPAC name is 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one.
Molecular Properties
| Compound Name | 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one |
| PubChem CID | 14770037 |
| Molecular Formula | C19H15NO2S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one |
| SMILES | CC(=O)c1cc(-c2ccccc2)c(=O)n2c1-c1sccc1CC2 |
| InChI | InChI=1S/C19H15NO2S/c1-12(21)15-11-16(13-5-3-2-4-6-13)19(22)20-9-7-14-8-10-23-18(14)17(15)20/h2-6,8,10-11H,7,9H2,1H3 |
| InChIKey | UNZJIMKLYVJDOC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one?
The IUPAC name of 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one (CID 14770037) is 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one.
What is the SMILES notation for 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one?
The canonical SMILES for 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one is CC(=O)c1cc(-c2ccccc2)c(=O)n2c1-c1sccc1CC2.
What is the InChIKey of 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one?
The InChIKey is UNZJIMKLYVJDOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO2S/c1-12(21)15-11-16(13-5-3-2-4-6-13)19(22)20-9-7-14-8-10-23-18(14)17(15)20/h2-6,8,10-11H,7,9H2,1H3.
What are the key properties of 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one?
10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one has a molecular weight of 321.40 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-acetyl-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one is sourced from PubChem (CID 14770037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).