C22H21NO4S2 — CID 14770187
tert-butyl 7,11-dioxo-12-phenyl-3,7lambda4-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,12-tetraene-14-carboxylate (PubChem CID 14770187) has the molecular formula C22H21NO4S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is tert-butyl 7,11-dioxo-12-phenyl-3,7lambda4-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,12-tetraene-14-carboxylate.
| Compound Name | tert-butyl 7,11-dioxo-12-phenyl-3,7lambda4-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,12-tetraene-14-carboxylate |
|---|---|
| PubChem CID | 14770187 |
| Molecular Formula | C22H21NO4S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | tert-butyl 7,11-dioxo-12-phenyl-3,7lambda4-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,12-tetraene-14-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(-c2ccccc2)c(=O)n2c1-c1sccc1S(=O)CC2 |
| InChI | InChI=1S/C22H21NO4S2/c1-22(2,3)27-21(25)16-13-15(14-7-5-4-6-8-14)20(24)23-10-12-29(26)17-9-11-28-19(17)18(16)23/h4-9,11,13H,10,12H2,1-3H3 |
| InChIKey | SQUFQLYMDBZCFH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |