C10H14N2O — CID 147702193
7,8-dimethyl-1,2,3,4-tetrahydro-1,5-naphthyridin-4-ol (PubChem CID 147702193) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 7,8-dimethyl-1,2,3,4-tetrahydro-1,5-naphthyridin-4-ol.
| Compound Name | 7,8-dimethyl-1,2,3,4-tetrahydro-1,5-naphthyridin-4-ol |
|---|---|
| PubChem CID | 147702193 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 7,8-dimethyl-1,2,3,4-tetrahydro-1,5-naphthyridin-4-ol |
| SMILES | Cc1cnc2c(c1C)NCCC2O |
| InChI | InChI=1S/C10H14N2O/c1-6-5-12-10-8(13)3-4-11-9(10)7(6)2/h5,8,11,13H,3-4H2,1-2H3 |
| InChIKey | GTBOZIIBBPIZMH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |