About 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol
2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol (PubChem CID 14770225) has the molecular formula C21H21NO2S
and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol |
| PubChem CID | 14770225 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol |
| SMILES | CC(CO)(CO)NCc1cccc2cc3c(cc12)sc1ccccc13 |
| InChI | InChI=1S/C21H21NO2S/c1-21(12-23,13-24)22-11-15-6-4-5-14-9-18-16-7-2-3-8-19(16)25-20(18)10-17(14)15/h2-10,22-24H,11-13H2,1H3 |
| InChIKey | CQCCSCBQCGQMMD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol?
The IUPAC name of 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol (CID 14770225) is 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol.
What is the SMILES notation for 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol?
The canonical SMILES for 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol is CC(CO)(CO)NCc1cccc2cc3c(cc12)sc1ccccc13.
What is the InChIKey of 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol?
The InChIKey is CQCCSCBQCGQMMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO2S/c1-21(12-23,13-24)22-11-15-6-4-5-14-9-18-16-7-2-3-8-19(16)25-20(18)10-17(14)15/h2-10,22-24H,11-13H2,1H3.
What are the key properties of 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol?
2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol has a molecular weight of 351.47 g/mol, XLogP of 4.04, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(naphtho[7,6-b][1]benzothiol-7-ylmethylamino)propane-1,3-diol is sourced from PubChem (CID 14770225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).