C29H31BF6O7S — CID 147702727
[5-(difluoromethyl)-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 147702727) has the molecular formula C29H31BF6O7S and a molecular weight of 648.43 g/mol. Its IUPAC name is [5-(difluoromethyl)-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-(trifluoromethylsulfonyloxy)benzoate.
| Compound Name | [5-(difluoromethyl)-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-(trifluoromethylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 147702727 |
| Molecular Formula | C29H31BF6O7S |
| Molecular Weight | 648.43 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | [5-(difluoromethyl)-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | CC1(C)CCC=C1c1cc(C(=O)OCc2cc(C(F)F)cc(B3OC(C)(C)C(C)(C)O3)c2F)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C29H31BF6O7S/c1-26(2)11-7-8-20(26)19-13-16(9-10-22(19)41-44(38,39)29(34,35)36)25(37)40-15-18-12-17(24(32)33)14-21(23(18)31)30-42-27(3,4)28(5,6)43-30/h8-10,12-14,24H,7,11,15H2,1-6H3 |
| InChIKey | GTEDXHVCPZECKN-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.43 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|