C32H26ClNO4 — CID 147703809
2-[4-[4-[3-[1-(2-chlorophenyl)ethoxycarbonylamino]-1H-inden-2-yl]phenyl]phenyl]acetic acid (PubChem CID 147703809) has the molecular formula C32H26ClNO4 and a molecular weight of 524.02 g/mol. Its IUPAC name is 2-[4-[4-[3-[1-(2-chlorophenyl)ethoxycarbonylamino]-1H-inden-2-yl]phenyl]phenyl]acetic acid.
| Compound Name | 2-[4-[4-[3-[1-(2-chlorophenyl)ethoxycarbonylamino]-1H-inden-2-yl]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 147703809 |
| Molecular Formula | C32H26ClNO4 |
| Molecular Weight | 524.02 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 2-[4-[4-[3-[1-(2-chlorophenyl)ethoxycarbonylamino]-1H-inden-2-yl]phenyl]phenyl]acetic acid |
| SMILES | CC(OC(=O)NC1=C(c2ccc(-c3ccc(CC(=O)O)cc3)cc2)Cc2ccccc21)c1ccccc1Cl |
| InChI | InChI=1S/C32H26ClNO4/c1-20(26-7-4-5-9-29(26)33)38-32(37)34-31-27-8-3-2-6-25(27)19-28(31)24-16-14-23(15-17-24)22-12-10-21(11-13-22)18-30(35)36/h2-17,20H,18-19H2,1H3,(H,34,37)(H,35,36) |
| InChIKey | GTJMXOOKNVMMJW-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.02 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|