C25H24FNO3 — CID 14770403
[3-(4-fluorophenyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl] pyridine-3-carboxylate (PubChem CID 14770403) has the molecular formula C25H24FNO3 and a molecular weight of 405.47 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl] pyridine-3-carboxylate.
| Compound Name | [3-(4-fluorophenyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 14770403 |
| Molecular Formula | C25H24FNO3 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [3-(4-fluorophenyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl] pyridine-3-carboxylate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)c1cccnc1)C(c1ccc(F)cc1)C(C)(C)O2 |
| InChI | InChI=1S/C25H24FNO3/c1-14-15(2)23-20(16(3)22(14)29-24(28)18-7-6-12-27-13-18)21(25(4,5)30-23)17-8-10-19(26)11-9-17/h6-13,21H,1-5H3 |
| InChIKey | SPOWPXAKQNRNQS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|