C44H62N4O16 — CID 147705585
2,3,7,8,12,13,17,18-octakis(2-methoxyethoxy)-21,23-dihydroporphyrin (PubChem CID 147705585) has the molecular formula C44H62N4O16 and a molecular weight of 902.99 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octakis(2-methoxyethoxy)-21,23-dihydroporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octakis(2-methoxyethoxy)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 147705585 |
| Molecular Formula | C44H62N4O16 |
| Molecular Weight | 902.99 g/mol |
| Exact Mass | 902.42 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octakis(2-methoxyethoxy)-21,23-dihydroporphyrin |
| SMILES | COCCOC1=C(OCCOC)c2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)c(OCCOC)c5OCCOC)C(OCCOC)=C4OCCOC)c(OCCOC)c3OCCOC |
| InChI | InChI=1S/C44H62N4O16/c1-49-9-17-57-37-29-25-31-39(59-19-11-51-3)41(61-21-13-53-5)33(46-31)27-35-43(63-23-15-55-7)44(64-24-16-56-8)36(48-35)28-34-42(62-22-14-54-6)40(60-20-12-52-4)32(47-34)26-30(45-29)38(37)58-18-10-50-2/h25-28,45,48H,9-24H2,1-8H3/b29-25-,30-26-,31-25-,32-26-,33-27-,34-28-,35-27-,36-28- |
| InChIKey | GTSARBNZUOHBTB-KUACJATHSA-N |
| XLogP | 4.72 |
| TPSA | 205.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.99 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|