C31H46N4O5Si — CID 147707650
2,2-dimethylpropyl [(2S)-2-[[6,6-dimethyl-3-[(1-trimethylsilylcyclobutanecarbonyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrrole-5-carbonyl]amino]-2-phenylethyl] carbonate (PubChem CID 147707650) has the molecular formula C31H46N4O5Si and a molecular weight of 582.82 g/mol. Its IUPAC name is 2,2-dimethylpropyl [(2S)-2-[[6,6-dimethyl-3-[(1-trimethylsilylcyclobutanecarbonyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrrole-5-carbonyl]amino]-2-phenylethyl] carbonate.
| Compound Name | 2,2-dimethylpropyl [(2S)-2-[[6,6-dimethyl-3-[(1-trimethylsilylcyclobutanecarbonyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrrole-5-carbonyl]amino]-2-phenylethyl] carbonate |
|---|---|
| PubChem CID | 147707650 |
| Molecular Formula | C31H46N4O5Si |
| Molecular Weight | 582.82 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | 2,2-dimethylpropyl [(2S)-2-[[6,6-dimethyl-3-[(1-trimethylsilylcyclobutanecarbonyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrrole-5-carbonyl]amino]-2-phenylethyl] carbonate |
| SMILES | CC(C)(C)COC(=O)OC[C@@H](NC(=O)N1CC2=C(CN=C2NC(=O)C2([Si](C)(C)C)CCC2)C1(C)C)c1ccccc1 |
| InChI | InChI=1S/C31H46N4O5Si/c1-29(2,3)20-40-28(38)39-19-24(21-13-10-9-11-14-21)33-27(37)35-18-22-23(30(35,4)5)17-32-25(22)34-26(36)31(15-12-16-31)41(6,7)8/h9-11,13-14,24H,12,15-20H2,1-8H3,(H,33,37)(H,32,34,36)/t24-/m1/s1 |
| InChIKey | GUCDESHZPPDKPR-XMMPIXPASA-N |
| XLogP | 5.82 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.82 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|