About ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate
ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate (PubChem CID 14770840) has the molecular formula C17H21F2NO3
and a molecular weight of 325.36 g/mol. Its IUPAC name is ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate.
Molecular Properties
| Compound Name | ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate |
| PubChem CID | 14770840 |
| Molecular Formula | C17H21F2NO3 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cc(F)c(C2CCN(C)CC2)cc1F |
| InChI | InChI=1S/C17H21F2NO3/c1-3-23-17(22)10-16(21)13-9-14(18)12(8-15(13)19)11-4-6-20(2)7-5-11/h8-9,11H,3-7,10H2,1-2H3 |
| InChIKey | PUQZNYQQNQAKOI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate?
The IUPAC name of ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate (CID 14770840) is ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate.
What is the SMILES notation for ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate?
The canonical SMILES for ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate is CCOC(=O)CC(=O)c1cc(F)c(C2CCN(C)CC2)cc1F.
What is the InChIKey of ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate?
The InChIKey is PUQZNYQQNQAKOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2NO3/c1-3-23-17(22)10-16(21)13-9-14(18)12(8-15(13)19)11-4-6-20(2)7-5-11/h8-9,11H,3-7,10H2,1-2H3.
What are the key properties of ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate?
ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate has a molecular weight of 325.36 g/mol, XLogP of 2.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate is sourced from PubChem (CID 14770840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).