About 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane
8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane (PubChem CID 14770852) has the molecular formula C13H13BrF2O2
and a molecular weight of 319.15 g/mol. Its IUPAC name is 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane |
| PubChem CID | 14770852 |
| Molecular Formula | C13H13BrF2O2 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane |
| SMILES | Fc1cc(C2CCC3(C2)OCCO3)c(F)cc1Br |
| InChI | InChI=1S/C13H13BrF2O2/c14-10-6-11(15)9(5-12(10)16)8-1-2-13(7-8)17-3-4-18-13/h5-6,8H,1-4,7H2 |
| InChIKey | UJLNZIZWSHRKRQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane?
The IUPAC name of 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane (CID 14770852) is 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane.
What is the SMILES notation for 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane?
The canonical SMILES for 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane is Fc1cc(C2CCC3(C2)OCCO3)c(F)cc1Br.
What is the InChIKey of 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane?
The InChIKey is UJLNZIZWSHRKRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrF2O2/c14-10-6-11(15)9(5-12(10)16)8-1-2-13(7-8)17-3-4-18-13/h5-6,8H,1-4,7H2.
What are the key properties of 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane?
8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane has a molecular weight of 319.15 g/mol, XLogP of 3.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-bromo-2,5-difluorophenyl)-1,4-dioxaspiro[4.4]nonane is sourced from PubChem (CID 14770852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).