C19H32O5 — CID 147709534
(2E,4S)-13,15-dihydroxy-4-pentyl-5,16-dioxabicyclo[10.4.0]hexadec-2-en-6-one (PubChem CID 147709534) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is (2E,4S)-13,15-dihydroxy-4-pentyl-5,16-dioxabicyclo[10.4.0]hexadec-2-en-6-one.
| Compound Name | (2E,4S)-13,15-dihydroxy-4-pentyl-5,16-dioxabicyclo[10.4.0]hexadec-2-en-6-one |
|---|---|
| PubChem CID | 147709534 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (2E,4S)-13,15-dihydroxy-4-pentyl-5,16-dioxabicyclo[10.4.0]hexadec-2-en-6-one |
| SMILES | CCCCC[C@H]1/C=C/C2OC(O)CC(O)C2CCCCCC(=O)O1 |
| InChI | InChI=1S/C19H32O5/c1-2-3-5-8-14-11-12-17-15(16(20)13-19(22)24-17)9-6-4-7-10-18(21)23-14/h11-12,14-17,19-20,22H,2-10,13H2,1H3/b12-11+/t14-,15?,16?,17?,19?/m0/s1 |
| InChIKey | GUKXHMBFCLVGNY-MZZAMVMGSA-N |
| XLogP | 3.08 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|