C12H19N3O — CID 147711505
3,9,15-triazabicyclo[9.3.1]pentadeca-1(14),11-dien-13-one (PubChem CID 147711505) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 3,9,15-triazabicyclo[9.3.1]pentadeca-1(14),11-dien-13-one.
| Compound Name | 3,9,15-triazabicyclo[9.3.1]pentadeca-1(14),11-dien-13-one |
|---|---|
| PubChem CID | 147711505 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3,9,15-triazabicyclo[9.3.1]pentadeca-1(14),11-dien-13-one |
| SMILES | O=c1cc2[nH]c(c1)CNCCCCCNC2 |
| InChI | InChI=1S/C12H19N3O/c16-12-6-10-8-13-4-2-1-3-5-14-9-11(7-12)15-10/h6-7,13-14H,1-5,8-9H2,(H,15,16) |
| InChIKey | GUUKSJBSAGJQFQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |