C17H23ClN4O — CID 14771162
N-[(6-butyl-3-pyridinyl)methyl]-4-chloro-3-ethyl-1-methylpyrazole-5-carboxamide (PubChem CID 14771162) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is N-[(6-butyl-3-pyridinyl)methyl]-4-chloro-3-ethyl-1-methylpyrazole-5-carboxamide.
| Compound Name | N-[(6-butyl-3-pyridinyl)methyl]-4-chloro-3-ethyl-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 14771162 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | N-[(6-butyl-3-pyridinyl)methyl]-4-chloro-3-ethyl-1-methylpyrazole-5-carboxamide |
| SMILES | CCCCc1ccc(CNC(=O)c2c(Cl)c(CC)nn2C)cn1 |
| InChI | InChI=1S/C17H23ClN4O/c1-4-6-7-13-9-8-12(10-19-13)11-20-17(23)16-15(18)14(5-2)21-22(16)3/h8-10H,4-7,11H2,1-3H3,(H,20,23) |
| InChIKey | FRLJNJCFXAPGIZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |