C19H26F3NO2 — CID 147711926
tert-butyl 3-[1-[4-(trifluoromethyl)phenyl]piperidin-3-yl]propanoate (PubChem CID 147711926) has the molecular formula C19H26F3NO2 and a molecular weight of 357.42 g/mol. Its IUPAC name is tert-butyl 3-[1-[4-(trifluoromethyl)phenyl]piperidin-3-yl]propanoate.
| Compound Name | tert-butyl 3-[1-[4-(trifluoromethyl)phenyl]piperidin-3-yl]propanoate |
|---|---|
| PubChem CID | 147711926 |
| Molecular Formula | C19H26F3NO2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | tert-butyl 3-[1-[4-(trifluoromethyl)phenyl]piperidin-3-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCC1CCCN(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C19H26F3NO2/c1-18(2,3)25-17(24)11-6-14-5-4-12-23(13-14)16-9-7-15(8-10-16)19(20,21)22/h7-10,14H,4-6,11-13H2,1-3H3 |
| InChIKey | GUWNHTRTGOLPFQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |