About cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+)
cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+) (PubChem CID 147713801) has the molecular formula C14H23NO5Pt
and a molecular weight of 480.42 g/mol. Its IUPAC name is cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+).
Molecular Properties
| Compound Name | cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+) |
| PubChem CID | 147713801 |
| Molecular Formula | C14H23NO5Pt |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+) |
| SMILES | O=C(O)C1(C(=O)O)CCC1.[CH2-]CC1(C[NH-])CCOCC1.[Pt+2] |
| InChI | InChI=1S/C8H15NO.C6H8O4.Pt/c1-2-8(7-9)3-5-10-6-4-8;7-4(8)6(5(9)10)2-1-3-6;/h9H,1-7H2;1-3H2,(H,7,8)(H,9,10);/q-2;;+2 |
| InChIKey | CLCXLPXQJUKIEI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+)?
The IUPAC name of cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+) (CID 147713801) is cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+).
What is the SMILES notation for cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+)?
The canonical SMILES for cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+) is O=C(O)C1(C(=O)O)CCC1.[CH2-]CC1(C[NH-])CCOCC1.[Pt+2].
What is the InChIKey of cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+)?
The InChIKey is CLCXLPXQJUKIEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.C6H8O4.Pt/c1-2-8(7-9)3-5-10-6-4-8;7-4(8)6(5(9)10)2-1-3-6;/h9H,1-7H2;1-3H2,(H,7,8)(H,9,10);/q-2;;+2.
What are the key properties of cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+)?
cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+) has a molecular weight of 480.42 g/mol, XLogP of 2.38, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutane-1,1-dicarboxylic acid;(4-ethyloxan-4-yl)methylazanide;platinum(2+) is sourced from PubChem (CID 147713801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).