About [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate
[(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate (PubChem CID 147714646) has the molecular formula C8H9N3O3
and a molecular weight of 195.18 g/mol. Its IUPAC name is [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate.
Molecular Properties
| Compound Name | [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate |
| PubChem CID | 147714646 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate |
| SMILES | O=C1C[C@H](OC(=O)n2ccnc2)CN1 |
| InChI | InChI=1S/C8H9N3O3/c12-7-3-6(4-10-7)14-8(13)11-2-1-9-5-11/h1-2,5-6H,3-4H2,(H,10,12)/t6-/m0/s1 |
| InChIKey | GVJVAYOIKCXJGN-LURJTMIESA-N |
| XLogP | -0.24 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate?
The IUPAC name of [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate (CID 147714646) is [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate.
What is the SMILES notation for [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate?
The canonical SMILES for [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate is O=C1C[C@H](OC(=O)n2ccnc2)CN1.
What is the InChIKey of [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate?
The InChIKey is GVJVAYOIKCXJGN-LURJTMIESA-N. The full InChI is InChI=1S/C8H9N3O3/c12-7-3-6(4-10-7)14-8(13)11-2-1-9-5-11/h1-2,5-6H,3-4H2,(H,10,12)/t6-/m0/s1.
What are the key properties of [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate?
[(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate has a molecular weight of 195.18 g/mol, XLogP of -0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-5-oxopyrrolidin-3-yl] imidazole-1-carboxylate is sourced from PubChem (CID 147714646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).