C30H33NO6S — CID 14771520
2-[3-[4-[(2-ethyl-1-benzofuran-3-yl)sulfonyl]phenoxy]propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 14771520) has the molecular formula C30H33NO6S and a molecular weight of 535.66 g/mol. Its IUPAC name is 2-[3-[4-[(2-ethyl-1-benzofuran-3-yl)sulfonyl]phenoxy]propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[3-[4-[(2-ethyl-1-benzofuran-3-yl)sulfonyl]phenoxy]propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 14771520 |
| Molecular Formula | C30H33NO6S |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 2-[3-[4-[(2-ethyl-1-benzofuran-3-yl)sulfonyl]phenoxy]propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | CCc1oc2ccccc2c1S(=O)(=O)c1ccc(OCCCN2CCc3cc(OC)c(OC)cc3C2)cc1 |
| InChI | InChI=1S/C30H33NO6S/c1-4-26-30(25-8-5-6-9-27(25)37-26)38(32,33)24-12-10-23(11-13-24)36-17-7-15-31-16-14-21-18-28(34-2)29(35-3)19-22(21)20-31/h5-6,8-13,18-19H,4,7,14-17,20H2,1-3H3 |
| InChIKey | SWJWCTFWLIVBED-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|