About 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol
4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol (PubChem CID 14771910) has the molecular formula C16H15ClO
and a molecular weight of 258.75 g/mol. Its IUPAC name is 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol |
| PubChem CID | 14771910 |
| Molecular Formula | C16H15ClO |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(/C=C/c2ccc(Cl)cc2)cc(C)c1O |
| InChI | InChI=1S/C16H15ClO/c1-11-9-14(10-12(2)16(11)18)4-3-13-5-7-15(17)8-6-13/h3-10,18H,1-2H3/b4-3+ |
| InChIKey | XGJUOAWVGROTMW-ONEGZZNKSA-N |
| XLogP | 4.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol?
The IUPAC name of 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol (CID 14771910) is 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol.
What is the SMILES notation for 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol?
The canonical SMILES for 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol is Cc1cc(/C=C/c2ccc(Cl)cc2)cc(C)c1O.
What is the InChIKey of 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol?
The InChIKey is XGJUOAWVGROTMW-ONEGZZNKSA-N. The full InChI is InChI=1S/C16H15ClO/c1-11-9-14(10-12(2)16(11)18)4-3-13-5-7-15(17)8-6-13/h3-10,18H,1-2H3/b4-3+.
What are the key properties of 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol?
4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol has a molecular weight of 258.75 g/mol, XLogP of 4.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(4-chlorophenyl)ethenyl]-2,6-dimethylphenol is sourced from PubChem (CID 14771910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).