About (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine
(3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine (PubChem CID 14771970) has the molecular formula C8H17NO4
and a molecular weight of 191.23 g/mol. Its IUPAC name is (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine.
Molecular Properties
| Compound Name | (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine |
| PubChem CID | 14771970 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine |
| SMILES | COCO[C@H]1CNC[C@H]1OCOC |
| InChI | InChI=1S/C8H17NO4/c1-10-5-12-7-3-9-4-8(7)13-6-11-2/h7-9H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | HUJDBIKWVYGQEC-OCAPTIKFSA-N |
| XLogP | -0.43 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine?
The IUPAC name of (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine (CID 14771970) is (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine.
What is the SMILES notation for (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine?
The canonical SMILES for (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine is COCO[C@H]1CNC[C@H]1OCOC.
What is the InChIKey of (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine?
The InChIKey is HUJDBIKWVYGQEC-OCAPTIKFSA-N. The full InChI is InChI=1S/C8H17NO4/c1-10-5-12-7-3-9-4-8(7)13-6-11-2/h7-9H,3-6H2,1-2H3/t7-,8+.
What are the key properties of (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine?
(3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine has a molecular weight of 191.23 g/mol, XLogP of -0.43, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3,4-bis(methoxymethoxy)pyrrolidine is sourced from PubChem (CID 14771970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).