C8H9N5O2S — CID 14772206
N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1,3-thiazol-2-amine (PubChem CID 14772206) has the molecular formula C8H9N5O2S and a molecular weight of 239.26 g/mol. Its IUPAC name is N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 14772206 |
| Molecular Formula | C8H9N5O2S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1,3-thiazol-2-amine |
| SMILES | COc1nc(Nc2nccs2)nc(OC)n1 |
| InChI | InChI=1S/C8H9N5O2S/c1-14-6-10-5(11-7(13-6)15-2)12-8-9-3-4-16-8/h3-4H,1-2H3,(H,9,10,11,12,13) |
| InChIKey | KAZABAFGQOZOJK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |