1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid

C16H10Cl2N2O2 — CID 1477238

IUPAC1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2)n1
InChIInChI=1S/C16H10Cl2N2O2/c17-11-3-1-10(2-4-11)15-9-14(16(21)22)19-20(15)13-7-5-12(18)6-8-13/h1-9H,(H,21,22)
InChIKeyVIPPBETYPPIQQW-UHFFFAOYSA-N
MW333.17 g/mol
LogP4.54
Rot. Bonds3

About 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid

1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid (PubChem CID 1477238) has the molecular formula C16H10Cl2N2O2 and a molecular weight of 333.17 g/mol. Its IUPAC name is 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid.

Molecular Properties

Compound Name1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid
PubChem CID1477238
Molecular FormulaC16H10Cl2N2O2
Molecular Weight333.17 g/mol
Exact Mass332.01
IUPAC Name1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2)n1
InChIInChI=1S/C16H10Cl2N2O2/c17-11-3-1-10(2-4-11)15-9-14(16(21)22)19-20(15)13-7-5-12(18)6-8-13/h1-9H,(H,21,22)
InChIKeyVIPPBETYPPIQQW-UHFFFAOYSA-N
XLogP4.54
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.17
LogP ≤ 54.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid?
The IUPAC name of 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid (CID 1477238) is 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid.
What is the SMILES notation for 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid?
The canonical SMILES for 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid is O=C(O)c1cc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2)n1.
What is the InChIKey of 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid?
The InChIKey is VIPPBETYPPIQQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2N2O2/c17-11-3-1-10(2-4-11)15-9-14(16(21)22)19-20(15)13-7-5-12(18)6-8-13/h1-9H,(H,21,22).
What are the key properties of 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid?
1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid has a molecular weight of 333.17 g/mol, XLogP of 4.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylic acid is sourced from PubChem (CID 1477238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).