About CID 147724003
CID 147724003 (PubChem CID 147724003) has the molecular formula C24H6BF6N9-
and a molecular weight of 545.18 g/mol.
Molecular Properties
| Compound Name | CID 147724003 |
| PubChem CID | 147724003 |
| Molecular Formula | C24H6BF6N9- |
| Molecular Weight | 545.18 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | — |
| SMILES | N#Cc1nn([B-](n2nc(C#N)c3cc(F)c(F)cc32)n2nc(C#N)c3cc(F)c(F)cc32)c2cc(F)c(F)cc12 |
| InChI | InChI=1S/C24H6BF6N9/c26-13-1-10-19(7-32)35-38(22(10)4-16(13)29)25(39-23-5-17(30)14(27)2-11(23)20(8-33)36-39)40-24-6-18(31)15(28)3-12(24)21(9-34)37-40/h1-6H/q-1 |
| InChIKey | ACELTMKVONNOOM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 124.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 545.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 147724003 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 147724003?
The IUPAC name of CID 147724003 (CID 147724003) is not available.
What is the SMILES notation for CID 147724003?
The canonical SMILES for CID 147724003 is N#Cc1nn([B-](n2nc(C#N)c3cc(F)c(F)cc32)n2nc(C#N)c3cc(F)c(F)cc32)c2cc(F)c(F)cc12.
What is the InChIKey of CID 147724003?
The InChIKey is ACELTMKVONNOOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H6BF6N9/c26-13-1-10-19(7-32)35-38(22(10)4-16(13)29)25(39-23-5-17(30)14(27)2-11(23)20(8-33)36-39)40-24-6-18(31)15(28)3-12(24)21(9-34)37-40/h1-6H/q-1.
What are the key properties of CID 147724003?
CID 147724003 has a molecular weight of 545.18 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 147724003 is sourced from PubChem (CID 147724003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).