C20H18N4O2S — CID 147728400
1-N-(5-isoquinolin-6-yl-1,3-oxazol-2-yl)-3-N-(methyl-methylidene-oxo-λ6-sulfanyl)benzene-1,3-diamine (PubChem CID 147728400) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is 1-N-(5-isoquinolin-6-yl-1,3-oxazol-2-yl)-3-N-(methyl-methylidene-oxo-λ6-sulfanyl)benzene-1,3-diamine.
| Compound Name | 1-N-(5-isoquinolin-6-yl-1,3-oxazol-2-yl)-3-N-(methyl-methylidene-oxo-λ6-sulfanyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 147728400 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-N-(5-isoquinolin-6-yl-1,3-oxazol-2-yl)-3-N-(methyl-methylidene-oxo-λ6-sulfanyl)benzene-1,3-diamine |
| SMILES | C=S(C)(=O)Nc1cccc(Nc2ncc(-c3ccc4cnccc4c3)o2)c1 |
| InChI | InChI=1S/C20H18N4O2S/c1-27(2,25)24-18-5-3-4-17(11-18)23-20-22-13-19(26-20)15-6-7-16-12-21-9-8-14(16)10-15/h3-13H,1H2,2H3,(H,22,23)(H,24,25) |
| InChIKey | GXYBCOATRSOJSG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|