About 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane
2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane (PubChem CID 14772859) has the molecular formula C12H13F3O3S
and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane.
Molecular Properties
| Compound Name | 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane |
| PubChem CID | 14772859 |
| Molecular Formula | C12H13F3O3S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane |
| SMILES | CC1(C(CS(=O)(=O)c2ccccc2)C(F)(F)F)CO1 |
| InChI | InChI=1S/C12H13F3O3S/c1-11(8-18-11)10(12(13,14)15)7-19(16,17)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3 |
| InChIKey | ZPBYXKGPRMUDKY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane?
The IUPAC name of 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane (CID 14772859) is 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane.
What is the SMILES notation for 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane?
The canonical SMILES for 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane is CC1(C(CS(=O)(=O)c2ccccc2)C(F)(F)F)CO1.
What is the InChIKey of 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane?
The InChIKey is ZPBYXKGPRMUDKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3O3S/c1-11(8-18-11)10(12(13,14)15)7-19(16,17)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3.
What are the key properties of 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane?
2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane has a molecular weight of 294.29 g/mol, XLogP of 2.43, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-yl]-2-methyloxirane is sourced from PubChem (CID 14772859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).