C27H36N2O6 — CID 147728896
(3R,4S)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-hydroxy-N-[2-(4-methoxyphenoxy)ethyl]-3-(piperidin-1-ylmethyl)butanamide (PubChem CID 147728896) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is (3R,4S)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-hydroxy-N-[2-(4-methoxyphenoxy)ethyl]-3-(piperidin-1-ylmethyl)butanamide.
| Compound Name | (3R,4S)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-hydroxy-N-[2-(4-methoxyphenoxy)ethyl]-3-(piperidin-1-ylmethyl)butanamide |
|---|---|
| PubChem CID | 147728896 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | (3R,4S)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-hydroxy-N-[2-(4-methoxyphenoxy)ethyl]-3-(piperidin-1-ylmethyl)butanamide |
| SMILES | COc1ccc(OCCNC(=O)C[C@H](CN2CCCCC2)[C@H](O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C27H36N2O6/c1-32-22-6-8-23(9-7-22)33-14-11-28-26(30)18-21(19-29-12-3-2-4-13-29)27(31)20-5-10-24-25(17-20)35-16-15-34-24/h5-10,17,21,27,31H,2-4,11-16,18-19H2,1H3,(H,28,30)/t21-,27-/m1/s1 |
| InChIKey | GYANXEGDMNYVIB-JIPXPUAJSA-N |
| XLogP | 3.19 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|