C10H10F6 — CID 147729970
2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-methylcyclohexa-1,3-diene (PubChem CID 147729970) has the molecular formula C10H10F6 and a molecular weight of 244.18 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-methylcyclohexa-1,3-diene.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 147729970 |
| Molecular Formula | C10H10F6 |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-methylcyclohexa-1,3-diene |
| SMILES | CC1C=C(C(C(F)(F)F)C(F)(F)F)C=CC1 |
| InChI | InChI=1S/C10H10F6/c1-6-3-2-4-7(5-6)8(9(11,12)13)10(14,15)16/h2,4-6,8H,3H2,1H3 |
| InChIKey | GYFNPJWUVSCQME-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |