About (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone
(4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone (PubChem CID 1477310) has the molecular formula C18H18ClNO
and a molecular weight of 299.80 g/mol. Its IUPAC name is (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone.
Molecular Properties
| Compound Name | (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone |
| PubChem CID | 1477310 |
| Molecular Formula | C18H18ClNO |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone |
| SMILES | CN1C[C@@H](C(=O)c2ccc(Cl)cc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C18H18ClNO/c1-20-11-16(13-5-3-2-4-6-13)17(12-20)18(21)14-7-9-15(19)10-8-14/h2-10,16-17H,11-12H2,1H3/t16-,17+/m0/s1 |
| InChIKey | GWFPZNWTHIITBJ-DLBZAZTESA-N |
| XLogP | 3.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone?
The IUPAC name of (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone (CID 1477310) is (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone.
What is the SMILES notation for (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone?
The canonical SMILES for (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone is CN1C[C@@H](C(=O)c2ccc(Cl)cc2)[C@H](c2ccccc2)C1.
What is the InChIKey of (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone?
The InChIKey is GWFPZNWTHIITBJ-DLBZAZTESA-N. The full InChI is InChI=1S/C18H18ClNO/c1-20-11-16(13-5-3-2-4-6-13)17(12-20)18(21)14-7-9-15(19)10-8-14/h2-10,16-17H,11-12H2,1H3/t16-,17+/m0/s1.
What are the key properties of (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone?
(4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone has a molecular weight of 299.80 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-[(3S,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methanone is sourced from PubChem (CID 1477310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).