C23H25FIN9O2 — CID 147734016
1-[4-[(4-fluorophenyl)methyl-methylamino]butyl]-3-[3-(5-iodo-1,3,4-oxadiazol-2-yl)-5-(1-methyltetrazol-5-yl)phenyl]urea (PubChem CID 147734016) has the molecular formula C23H25FIN9O2 and a molecular weight of 605.42 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)methyl-methylamino]butyl]-3-[3-(5-iodo-1,3,4-oxadiazol-2-yl)-5-(1-methyltetrazol-5-yl)phenyl]urea.
| Compound Name | 1-[4-[(4-fluorophenyl)methyl-methylamino]butyl]-3-[3-(5-iodo-1,3,4-oxadiazol-2-yl)-5-(1-methyltetrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 147734016 |
| Molecular Formula | C23H25FIN9O2 |
| Molecular Weight | 605.42 g/mol |
| Exact Mass | 605.12 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)methyl-methylamino]butyl]-3-[3-(5-iodo-1,3,4-oxadiazol-2-yl)-5-(1-methyltetrazol-5-yl)phenyl]urea |
| SMILES | CN(CCCCNC(=O)Nc1cc(-c2nnc(I)o2)cc(-c2nnnn2C)c1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H25FIN9O2/c1-33(14-15-5-7-18(24)8-6-15)10-4-3-9-26-23(35)27-19-12-16(20-28-31-32-34(20)2)11-17(13-19)21-29-30-22(25)36-21/h5-8,11-13H,3-4,9-10,14H2,1-2H3,(H2,26,27,35) |
| InChIKey | GYZLQRLIGDLBJM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|