C15H16Cl2O4 — CID 14773457
prop-2-enyl 2-[(2R,4R)-6,7-dichloro-4-hydroxy-2-methyl-2,3-dihydrochromen-4-yl]acetate (PubChem CID 14773457) has the molecular formula C15H16Cl2O4 and a molecular weight of 331.20 g/mol. Its IUPAC name is prop-2-enyl 2-[(2R,4R)-6,7-dichloro-4-hydroxy-2-methyl-2,3-dihydrochromen-4-yl]acetate.
| Compound Name | prop-2-enyl 2-[(2R,4R)-6,7-dichloro-4-hydroxy-2-methyl-2,3-dihydrochromen-4-yl]acetate |
|---|---|
| PubChem CID | 14773457 |
| Molecular Formula | C15H16Cl2O4 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | prop-2-enyl 2-[(2R,4R)-6,7-dichloro-4-hydroxy-2-methyl-2,3-dihydrochromen-4-yl]acetate |
| SMILES | C=CCOC(=O)C[C@]1(O)C[C@@H](C)Oc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C15H16Cl2O4/c1-3-4-20-14(18)8-15(19)7-9(2)21-13-6-12(17)11(16)5-10(13)15/h3,5-6,9,19H,1,4,7-8H2,2H3/t9-,15-/m1/s1 |
| InChIKey | PYKULNXLPKLHQX-RFAUZJTJSA-N |
| XLogP | 3.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|