C17H27NO6 — CID 147734748
2-[(3R,6R,7S,7aS)-3-tert-butyl-7a-methoxycarbonyl-5-oxo-7-propyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-yl]acetic acid (PubChem CID 147734748) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is 2-[(3R,6R,7S,7aS)-3-tert-butyl-7a-methoxycarbonyl-5-oxo-7-propyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-yl]acetic acid.
| Compound Name | 2-[(3R,6R,7S,7aS)-3-tert-butyl-7a-methoxycarbonyl-5-oxo-7-propyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-yl]acetic acid |
|---|---|
| PubChem CID | 147734748 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-[(3R,6R,7S,7aS)-3-tert-butyl-7a-methoxycarbonyl-5-oxo-7-propyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-yl]acetic acid |
| SMILES | CCC[C@H]1[C@@H](CC(=O)O)C(=O)N2[C@@H](C(C)(C)C)OC[C@]12C(=O)OC |
| InChI | InChI=1S/C17H27NO6/c1-6-7-11-10(8-12(19)20)13(21)18-14(16(2,3)4)24-9-17(11,18)15(22)23-5/h10-11,14H,6-9H2,1-5H3,(H,19,20)/t10-,11+,14-,17-/m1/s1 |
| InChIKey | GZDBNUXHXPYRIM-KOZDUTSQSA-N |
| XLogP | 1.65 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |