About 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid
9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid (PubChem CID 14773532) has the molecular formula C24H16FNO2
and a molecular weight of 369.40 g/mol. Its IUPAC name is 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid.
Molecular Properties
| Compound Name | 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid |
| PubChem CID | 14773532 |
| Molecular Formula | C24H16FNO2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid |
| SMILES | O=C(O)c1c2c(nc3ccc(F)cc13)-c1ccc(-c3ccccc3)cc1CC2 |
| InChI | InChI=1S/C24H16FNO2/c25-17-8-11-21-20(13-17)22(24(27)28)19-10-7-16-12-15(14-4-2-1-3-5-14)6-9-18(16)23(19)26-21/h1-6,8-9,11-13H,7,10H2,(H,27,28) |
| InChIKey | UBSQJZPELRCTMC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid?
The IUPAC name of 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid (CID 14773532) is 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid.
What is the SMILES notation for 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid?
The canonical SMILES for 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid is O=C(O)c1c2c(nc3ccc(F)cc13)-c1ccc(-c3ccccc3)cc1CC2.
What is the InChIKey of 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid?
The InChIKey is UBSQJZPELRCTMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16FNO2/c25-17-8-11-21-20(13-17)22(24(27)28)19-10-7-16-12-15(14-4-2-1-3-5-14)6-9-18(16)23(19)26-21/h1-6,8-9,11-13H,7,10H2,(H,27,28).
What are the key properties of 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid?
9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid has a molecular weight of 369.40 g/mol, XLogP of 5.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylic acid is sourced from PubChem (CID 14773532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).