C40H32N4 — CID 147735698
2-[3,5-bis(2,3-dimethylindol-1-yl)phenyl]-4-phenylquinazoline (PubChem CID 147735698) has the molecular formula C40H32N4 and a molecular weight of 568.72 g/mol. Its IUPAC name is 2-[3,5-bis(2,3-dimethylindol-1-yl)phenyl]-4-phenylquinazoline.
| Compound Name | 2-[3,5-bis(2,3-dimethylindol-1-yl)phenyl]-4-phenylquinazoline |
|---|---|
| PubChem CID | 147735698 |
| Molecular Formula | C40H32N4 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 2-[3,5-bis(2,3-dimethylindol-1-yl)phenyl]-4-phenylquinazoline |
| SMILES | Cc1c(C)n(-c2cc(-c3nc(-c4ccccc4)c4ccccc4n3)cc(-n3c(C)c(C)c4ccccc43)c2)c2ccccc12 |
| InChI | InChI=1S/C40H32N4/c1-25-27(3)43(37-20-12-9-16-33(25)37)31-22-30(23-32(24-31)44-28(4)26(2)34-17-10-13-21-38(34)44)40-41-36-19-11-8-18-35(36)39(42-40)29-14-6-5-7-15-29/h5-24H,1-4H3 |
| InChIKey | GZHZJSXXVCENIH-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |