C57H33F9N6 — CID 147737004
2,4,6-tris[4-[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]phenyl]-1,3,5-triazine (PubChem CID 147737004) has the molecular formula C57H33F9N6 and a molecular weight of 972.92 g/mol. Its IUPAC name is 2,4,6-tris[4-[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[4-[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 147737004 |
| Molecular Formula | C57H33F9N6 |
| Molecular Weight | 972.92 g/mol |
| Exact Mass | 972.26 |
| IUPAC Name | 2,4,6-tris[4-[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]phenyl]-1,3,5-triazine |
| SMILES | FC(F)(F)c1ccc(-c2ccccn2)c(-c2ccc(-c3nc(-c4ccc(-c5cc(C(F)(F)F)ccc5-c5ccccn5)cc4)nc(-c4ccc(-c5cc(C(F)(F)F)ccc5-c5ccccn5)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C57H33F9N6/c58-55(59,60)40-22-25-43(49-7-1-4-28-67-49)46(31-40)34-10-16-37(17-11-34)52-70-53(38-18-12-35(13-19-38)47-32-41(56(61,62)63)23-26-44(47)50-8-2-5-29-68-50)72-54(71-52)39-20-14-36(15-21-39)48-33-42(57(64,65)66)24-27-45(48)51-9-3-6-30-69-51/h1-33H |
| InChIKey | GZOKXFDTECYJDN-UHFFFAOYSA-N |
| XLogP | 16.12 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.92 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |