C10H12F3NO — CID 1477380
(2S)-3-(benzylamino)-1,1,1-trifluoropropan-2-ol (PubChem CID 1477380) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is (2S)-3-(benzylamino)-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-3-(benzylamino)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 1477380 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2S)-3-(benzylamino)-1,1,1-trifluoropropan-2-ol |
| SMILES | O[C@@H](CNCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO/c11-10(12,13)9(15)7-14-6-8-4-2-1-3-5-8/h1-5,9,14-15H,6-7H2/t9-/m0/s1 |
| InChIKey | NKTRJOFXPSASPC-VIFPVBQESA-N |
| XLogP | 1.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |