C34H33BN6O3 — CID 147739094
5-(furan-2-yl)-6-[8-methyl-3-[2-[4,5,5-trimethyl-2-(8-methylquinolin-6-yl)-1,3,2-dioxaborolan-4-yl]ethyl]quinolin-6-yl]-1,2,4-triazin-3-amine (PubChem CID 147739094) has the molecular formula C34H33BN6O3 and a molecular weight of 584.49 g/mol. Its IUPAC name is 5-(furan-2-yl)-6-[8-methyl-3-[2-[4,5,5-trimethyl-2-(8-methylquinolin-6-yl)-1,3,2-dioxaborolan-4-yl]ethyl]quinolin-6-yl]-1,2,4-triazin-3-amine.
| Compound Name | 5-(furan-2-yl)-6-[8-methyl-3-[2-[4,5,5-trimethyl-2-(8-methylquinolin-6-yl)-1,3,2-dioxaborolan-4-yl]ethyl]quinolin-6-yl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 147739094 |
| Molecular Formula | C34H33BN6O3 |
| Molecular Weight | 584.49 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 5-(furan-2-yl)-6-[8-methyl-3-[2-[4,5,5-trimethyl-2-(8-methylquinolin-6-yl)-1,3,2-dioxaborolan-4-yl]ethyl]quinolin-6-yl]-1,2,4-triazin-3-amine |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(CCc3cnc4c(C)cc(-c5nnc(N)nc5-c5ccco5)cc4c3)O2)cc2cccnc12 |
| InChI | InChI=1S/C34H33BN6O3/c1-20-14-24(30-31(27-9-7-13-42-27)39-32(36)41-40-30)17-25-16-22(19-38-29(20)25)10-11-34(5)33(3,4)43-35(44-34)26-15-21(2)28-23(18-26)8-6-12-37-28/h6-9,12-19H,10-11H2,1-5H3,(H2,36,39,41) |
| InChIKey | GZYQGHNUNABSGU-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|