C20H22FN10O9P2S+ — CID 147741338
8,17-bis(6-aminopurin-9-yl)-18-fluoro-3-hydroxy-12-oxo-3-sulfanylidene-2,4,7,11,13,16-hexaoxa-3λ5-phospha-12-phosphoniatricyclo[13.2.1.06,10]octadecan-9-ol (PubChem CID 147741338) has the molecular formula C20H22FN10O9P2S+ and a molecular weight of 659.47 g/mol. Its IUPAC name is 8,17-bis(6-aminopurin-9-yl)-18-fluoro-3-hydroxy-12-oxo-3-sulfanylidene-2,4,7,11,13,16-hexaoxa-3λ5-phospha-12-phosphoniatricyclo[13.2.1.06,10]octadecan-9-ol.
| Compound Name | 8,17-bis(6-aminopurin-9-yl)-18-fluoro-3-hydroxy-12-oxo-3-sulfanylidene-2,4,7,11,13,16-hexaoxa-3λ5-phospha-12-phosphoniatricyclo[13.2.1.06,10]octadecan-9-ol |
|---|---|
| PubChem CID | 147741338 |
| Molecular Formula | C20H22FN10O9P2S+ |
| Molecular Weight | 659.47 g/mol |
| Exact Mass | 659.07 |
| IUPAC Name | 8,17-bis(6-aminopurin-9-yl)-18-fluoro-3-hydroxy-12-oxo-3-sulfanylidene-2,4,7,11,13,16-hexaoxa-3λ5-phospha-12-phosphoniatricyclo[13.2.1.06,10]octadecan-9-ol |
| SMILES | Nc1ncnc2c1ncn2C1OC2COP(O)(=S)OC3C(F)C(CO[P+](=O)OC2C1O)OC3n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H21FN10O9P2S/c21-9-7-1-35-41(33)39-13-8(38-19(12(13)32)30-5-28-10-15(22)24-3-26-17(10)30)2-36-42(34,43)40-14(9)20(37-7)31-6-29-11-16(23)25-4-27-18(11)31/h3-9,12-14,19-20,32H,1-2H2,(H4-,22,23,24,25,26,27,34,43)/p+1 |
| InChIKey | YPVDYTKDJOZXCQ-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 252.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.47 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|