C9H5F4NO — CID 14774191
3-fluoro-4-(2,2,2-trifluoroethoxy)benzonitrile (PubChem CID 14774191) has the molecular formula C9H5F4NO and a molecular weight of 219.14 g/mol. Its IUPAC name is 3-fluoro-4-(2,2,2-trifluoroethoxy)benzonitrile.
| Compound Name | 3-fluoro-4-(2,2,2-trifluoroethoxy)benzonitrile |
|---|---|
| PubChem CID | 14774191 |
| Molecular Formula | C9H5F4NO |
| Molecular Weight | 219.14 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 3-fluoro-4-(2,2,2-trifluoroethoxy)benzonitrile |
| SMILES | N#Cc1ccc(OCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C9H5F4NO/c10-7-3-6(4-14)1-2-8(7)15-5-9(11,12)13/h1-3H,5H2 |
| InChIKey | WARKARGXQLVSEZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.14 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |