C12H18F2O8 — CID 147744933
(2R,4S,5R)-2,3-difluoro-4-hydroxy-5-(2-oxopropyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 147744933) has the molecular formula C12H18F2O8 and a molecular weight of 328.26 g/mol. Its IUPAC name is (2R,4S,5R)-2,3-difluoro-4-hydroxy-5-(2-oxopropyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R)-2,3-difluoro-4-hydroxy-5-(2-oxopropyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 147744933 |
| Molecular Formula | C12H18F2O8 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (2R,4S,5R)-2,3-difluoro-4-hydroxy-5-(2-oxopropyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)C[C@H]1C([C@H](O)[C@H](O)CO)O[C@@](F)(C(=O)O)C(F)[C@H]1O |
| InChI | InChI=1S/C12H18F2O8/c1-4(16)2-5-7(18)10(13)12(14,11(20)21)22-9(5)8(19)6(17)3-15/h5-10,15,17-19H,2-3H2,1H3,(H,20,21)/t5-,6-,7+,8-,9?,10?,12-/m1/s1 |
| InChIKey | HBBRZMGMKKTDRQ-AOXSFYQRSA-N |
| XLogP | -1.86 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |