C14H15Cl3N2O2 — CID 14774534
2,2-dichloro-N-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 14774534) has the molecular formula C14H15Cl3N2O2 and a molecular weight of 349.65 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 14774534 |
| Molecular Formula | C14H15Cl3N2O2 |
| Molecular Weight | 349.65 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 2,2-dichloro-N-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NCC(=O)NCc2ccccc2Cl)CC1(Cl)Cl |
| InChI | InChI=1S/C14H15Cl3N2O2/c1-13(8-14(13,16)17)12(21)19-7-11(20)18-6-9-4-2-3-5-10(9)15/h2-5H,6-8H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | LSUQSLXOGJHSPX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.65 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|