About [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate
[3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 14774604) has the molecular formula C20H24O12
and a molecular weight of 456.40 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate |
| PubChem CID | 14774604 |
| Molecular Formula | C20H24O12 |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2c(C)occc2=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C20H24O12/c1-9-16(14(25)6-7-26-9)32-20-19(30-13(5)24)18(29-12(4)23)17(28-11(3)22)15(31-20)8-27-10(2)21/h6-7,15,17-20H,8H2,1-5H3 |
| InChIKey | WDRJBSQMNJKJGH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 153.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate?
The IUPAC name of [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate (CID 14774604) is [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate.
What is the SMILES notation for [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate?
The canonical SMILES for [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate is CC(=O)OCC1OC(Oc2c(C)occc2=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate?
The InChIKey is WDRJBSQMNJKJGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O12/c1-9-16(14(25)6-7-26-9)32-20-19(30-13(5)24)18(29-12(4)23)17(28-11(3)22)15(31-20)8-27-10(2)21/h6-7,15,17-20H,8H2,1-5H3.
What are the key properties of [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate?
[3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate has a molecular weight of 456.40 g/mol, XLogP of 0.41, 7 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4,5-triacetyloxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methyl acetate is sourced from PubChem (CID 14774604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).