C6H8O4 — CID 147754023
cyclohexa-2,6-diene-1,2,4,5-tetrol (PubChem CID 147754023) has the molecular formula C6H8O4 and a molecular weight of 144.13 g/mol. Its IUPAC name is cyclohexa-2,6-diene-1,2,4,5-tetrol.
| Compound Name | cyclohexa-2,6-diene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 147754023 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | cyclohexa-2,6-diene-1,2,4,5-tetrol |
| SMILES | OC1=CC(O)C(O)C=C1O |
| InChI | InChI=1S/C6H8O4/c7-3-1-4(8)6(10)2-5(3)9/h1-3,5,7-10H |
| InChIKey | HCTKKNGBJNQYFO-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |