About 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one
6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one (PubChem CID 147755507) has the molecular formula C4H5FIN3O
and a molecular weight of 257.01 g/mol. Its IUPAC name is 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one |
| PubChem CID | 147755507 |
| Molecular Formula | C4H5FIN3O |
| Molecular Weight | 257.01 g/mol |
| Exact Mass | 256.95 |
| IUPAC Name | 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one |
| SMILES | NC1NC(=O)N(I)C=C1F |
| InChI | InChI=1S/C4H5FIN3O/c5-2-1-9(6)4(10)8-3(2)7/h1,3H,7H2,(H,8,10) |
| InChIKey | HDAOJMRCCCCYMR-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.01 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one?
The IUPAC name of 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one (CID 147755507) is 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one.
What is the SMILES notation for 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one?
The canonical SMILES for 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one is NC1NC(=O)N(I)C=C1F.
What is the InChIKey of 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one?
The InChIKey is HDAOJMRCCCCYMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5FIN3O/c5-2-1-9(6)4(10)8-3(2)7/h1,3H,7H2,(H,8,10).
What are the key properties of 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one?
6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one has a molecular weight of 257.01 g/mol, XLogP of 0.46, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-fluoro-3-iodo-1,6-dihydropyrimidin-2-one is sourced from PubChem (CID 147755507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).