C19H18O — CID 14775675
(2E,4E,6E)-7-azulen-2-yl-3-methylocta-2,4,6-trienal (PubChem CID 14775675) has the molecular formula C19H18O and a molecular weight of 262.35 g/mol. Its IUPAC name is (2E,4E,6E)-7-azulen-2-yl-3-methylocta-2,4,6-trienal.
| Compound Name | (2E,4E,6E)-7-azulen-2-yl-3-methylocta-2,4,6-trienal |
|---|---|
| PubChem CID | 14775675 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (2E,4E,6E)-7-azulen-2-yl-3-methylocta-2,4,6-trienal |
| SMILES | CC(/C=C/C=C(\C)c1cc2cccccc-2c1)=C\C=O |
| InChI | InChI=1S/C19H18O/c1-15(11-12-20)7-6-8-16(2)19-13-17-9-4-3-5-10-18(17)14-19/h3-14H,1-2H3/b7-6+,15-11+,16-8+ |
| InChIKey | CPQJZQUXADETKL-GRUIEVMXSA-N |
| XLogP | 4.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|