About (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea
(4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea (PubChem CID 1477620) has the molecular formula C9H11N5S
and a molecular weight of 221.29 g/mol. Its IUPAC name is (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea.
Molecular Properties
| Compound Name | (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea |
| PubChem CID | 1477620 |
| Molecular Formula | C9H11N5S |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea |
| SMILES | Cc1cc(C)c2c(NC(N)=S)n[nH]c2n1 |
| InChI | InChI=1S/C9H11N5S/c1-4-3-5(2)11-7-6(4)8(14-13-7)12-9(10)15/h3H,1-2H3,(H4,10,11,12,13,14,15) |
| InChIKey | YXLQBDKPNQXRAM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea?
The IUPAC name of (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea (CID 1477620) is (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea.
What is the SMILES notation for (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea?
The canonical SMILES for (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea is Cc1cc(C)c2c(NC(N)=S)n[nH]c2n1.
What is the InChIKey of (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea?
The InChIKey is YXLQBDKPNQXRAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5S/c1-4-3-5(2)11-7-6(4)8(14-13-7)12-9(10)15/h3H,1-2H3,(H4,10,11,12,13,14,15).
What are the key properties of (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea?
(4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea has a molecular weight of 221.29 g/mol, XLogP of 1.23, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)thiourea is sourced from PubChem (CID 1477620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).