C19H25F3N2O4 — CID 147762771
(4S)-2,2,5,5-tetramethyl-N-[(2S)-2-[(2,4,5-trifluorobenzoyl)amino]propyl]-1,3-dioxane-4-carboxamide (PubChem CID 147762771) has the molecular formula C19H25F3N2O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is (4S)-2,2,5,5-tetramethyl-N-[(2S)-2-[(2,4,5-trifluorobenzoyl)amino]propyl]-1,3-dioxane-4-carboxamide.
| Compound Name | (4S)-2,2,5,5-tetramethyl-N-[(2S)-2-[(2,4,5-trifluorobenzoyl)amino]propyl]-1,3-dioxane-4-carboxamide |
|---|---|
| PubChem CID | 147762771 |
| Molecular Formula | C19H25F3N2O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (4S)-2,2,5,5-tetramethyl-N-[(2S)-2-[(2,4,5-trifluorobenzoyl)amino]propyl]-1,3-dioxane-4-carboxamide |
| SMILES | C[C@@H](CNC(=O)[C@H]1OC(C)(C)OCC1(C)C)NC(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H25F3N2O4/c1-10(24-16(25)11-6-13(21)14(22)7-12(11)20)8-23-17(26)15-18(2,3)9-27-19(4,5)28-15/h6-7,10,15H,8-9H2,1-5H3,(H,23,26)(H,24,25)/t10-,15+/m0/s1 |
| InChIKey | HEKDNGWXYHWYLS-ZUZCIYMTSA-N |
| XLogP | 2.52 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|