C24H27FN2O6S — CID 147763880
methyl 8-[[2-fluoro-5-(2-hydroxypropan-2-yl)phenyl]sulfonylcarbamoylamino]-1,2,3,5,6,7-hexahydro-s-indacene-4-carboxylate (PubChem CID 147763880) has the molecular formula C24H27FN2O6S and a molecular weight of 490.55 g/mol. Its IUPAC name is methyl 8-[[2-fluoro-5-(2-hydroxypropan-2-yl)phenyl]sulfonylcarbamoylamino]-1,2,3,5,6,7-hexahydro-s-indacene-4-carboxylate.
| Compound Name | methyl 8-[[2-fluoro-5-(2-hydroxypropan-2-yl)phenyl]sulfonylcarbamoylamino]-1,2,3,5,6,7-hexahydro-s-indacene-4-carboxylate |
|---|---|
| PubChem CID | 147763880 |
| Molecular Formula | C24H27FN2O6S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | methyl 8-[[2-fluoro-5-(2-hydroxypropan-2-yl)phenyl]sulfonylcarbamoylamino]-1,2,3,5,6,7-hexahydro-s-indacene-4-carboxylate |
| SMILES | COC(=O)c1c2c(c(NC(=O)NS(=O)(=O)c3cc(C(C)(C)O)ccc3F)c3c1CCC3)CCC2 |
| InChI | InChI=1S/C24H27FN2O6S/c1-24(2,30)13-10-11-18(25)19(12-13)34(31,32)27-23(29)26-21-16-8-4-6-14(16)20(22(28)33-3)15-7-5-9-17(15)21/h10-12,30H,4-9H2,1-3H3,(H2,26,27,29) |
| InChIKey | HEPPGYVVIIDWKW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |