About 5-bromo-2,4-diethoxypyrimidine
5-bromo-2,4-diethoxypyrimidine (PubChem CID 14776516) has the molecular formula C8H11BrN2O2
and a molecular weight of 247.09 g/mol. Its IUPAC name is 5-bromo-2,4-diethoxypyrimidine.
Molecular Properties
| Compound Name | 5-bromo-2,4-diethoxypyrimidine |
| PubChem CID | 14776516 |
| Molecular Formula | C8H11BrN2O2 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 5-bromo-2,4-diethoxypyrimidine |
| SMILES | CCOc1ncc(Br)c(OCC)n1 |
| InChI | InChI=1S/C8H11BrN2O2/c1-3-12-7-6(9)5-10-8(11-7)13-4-2/h5H,3-4H2,1-2H3 |
| InChIKey | ZCDUGAGUVHOMPG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2,4-diethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,4-diethoxypyrimidine?
The IUPAC name of 5-bromo-2,4-diethoxypyrimidine (CID 14776516) is 5-bromo-2,4-diethoxypyrimidine.
What is the SMILES notation for 5-bromo-2,4-diethoxypyrimidine?
The canonical SMILES for 5-bromo-2,4-diethoxypyrimidine is CCOc1ncc(Br)c(OCC)n1.
What is the InChIKey of 5-bromo-2,4-diethoxypyrimidine?
The InChIKey is ZCDUGAGUVHOMPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN2O2/c1-3-12-7-6(9)5-10-8(11-7)13-4-2/h5H,3-4H2,1-2H3.
What are the key properties of 5-bromo-2,4-diethoxypyrimidine?
5-bromo-2,4-diethoxypyrimidine has a molecular weight of 247.09 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,4-diethoxypyrimidine is sourced from PubChem (CID 14776516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).