C24H28O2S — CID 14776662
methyl 4-[(E)-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoate (PubChem CID 14776662) has the molecular formula C24H28O2S and a molecular weight of 380.55 g/mol. Its IUPAC name is methyl 4-[(E)-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 14776662 |
| Molecular Formula | C24H28O2S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | methyl 4-[(E)-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(\C)c2ccc3c(c2)C(C)(C)CC(C)(C)S3)cc1 |
| InChI | InChI=1S/C24H28O2S/c1-16(13-17-7-9-18(10-8-17)22(25)26-6)19-11-12-21-20(14-19)23(2,3)15-24(4,5)27-21/h7-14H,15H2,1-6H3/b16-13+ |
| InChIKey | CLUAQQDHHBGVEE-DTQAZKPQSA-N |
| XLogP | 6.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|